C22H30N2O7S — CID 46135412
[2-methoxy-5-[[2-methoxyethyl(propan-2-ylcarbamoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate (PubChem CID 46135412) has the molecular formula C22H30N2O7S and a molecular weight of 466.56 g/mol. Its IUPAC name is [2-methoxy-5-[[2-methoxyethyl(propan-2-ylcarbamoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate.
| Compound Name | [2-methoxy-5-[[2-methoxyethyl(propan-2-ylcarbamoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 46135412 |
| Molecular Formula | C22H30N2O7S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | [2-methoxy-5-[[2-methoxyethyl(propan-2-ylcarbamoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate |
| SMILES | COCCN(Cc1ccc(OC)c(OS(=O)(=O)c2ccc(OC)cc2)c1)C(=O)NC(C)C |
| InChI | InChI=1S/C22H30N2O7S/c1-16(2)23-22(25)24(12-13-28-3)15-17-6-11-20(30-5)21(14-17)31-32(26,27)19-9-7-18(29-4)8-10-19/h6-11,14,16H,12-13,15H2,1-5H3,(H,23,25) |
| InChIKey | XGEDZQYKVXXWGN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|