C22H29FN2O5S — CID 46135402
[5-[[butan-2-yl(propan-2-ylcarbamoyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate (PubChem CID 46135402) has the molecular formula C22H29FN2O5S and a molecular weight of 452.55 g/mol. Its IUPAC name is [5-[[butan-2-yl(propan-2-ylcarbamoyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate.
| Compound Name | [5-[[butan-2-yl(propan-2-ylcarbamoyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 46135402 |
| Molecular Formula | C22H29FN2O5S |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | [5-[[butan-2-yl(propan-2-ylcarbamoyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
| SMILES | CCC(C)N(Cc1ccc(OC)c(OS(=O)(=O)c2ccc(F)cc2)c1)C(=O)NC(C)C |
| InChI | InChI=1S/C22H29FN2O5S/c1-6-16(4)25(22(26)24-15(2)3)14-17-7-12-20(29-5)21(13-17)30-31(27,28)19-10-8-18(23)9-11-19/h7-13,15-16H,6,14H2,1-5H3,(H,24,26) |
| InChIKey | YYAUGUIWUCJKFG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|