C21H26FNO6S — CID 93110757
[5-[[[(2S)-butan-2-yl]-(2-methoxyacetyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate (PubChem CID 93110757) has the molecular formula C21H26FNO6S and a molecular weight of 439.51 g/mol. Its IUPAC name is [5-[[[(2S)-butan-2-yl]-(2-methoxyacetyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate.
| Compound Name | [5-[[[(2S)-butan-2-yl]-(2-methoxyacetyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 93110757 |
| Molecular Formula | C21H26FNO6S |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | [5-[[[(2S)-butan-2-yl]-(2-methoxyacetyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
| SMILES | CC[C@H](C)N(Cc1ccc(OC)c(OS(=O)(=O)c2ccc(F)cc2)c1)C(=O)COC |
| InChI | InChI=1S/C21H26FNO6S/c1-5-15(2)23(21(24)14-27-3)13-16-6-11-19(28-4)20(12-16)29-30(25,26)18-9-7-17(22)8-10-18/h6-12,15H,5,13-14H2,1-4H3/t15-/m0/s1 |
| InChIKey | MUYNLIYYINDEAF-HNNXBMFYSA-N |
| XLogP | 3.38 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|