C25H25F2NO5S — CID 46123272
[5-[[butan-2-yl-(2-fluorobenzoyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate (PubChem CID 46123272) has the molecular formula C25H25F2NO5S and a molecular weight of 489.54 g/mol. Its IUPAC name is [5-[[butan-2-yl-(2-fluorobenzoyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate.
| Compound Name | [5-[[butan-2-yl-(2-fluorobenzoyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 46123272 |
| Molecular Formula | C25H25F2NO5S |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | [5-[[butan-2-yl-(2-fluorobenzoyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
| SMILES | CCC(C)N(Cc1ccc(OC)c(OS(=O)(=O)c2ccc(F)cc2)c1)C(=O)c1ccccc1F |
| InChI | InChI=1S/C25H25F2NO5S/c1-4-17(2)28(25(29)21-7-5-6-8-22(21)27)16-18-9-14-23(32-3)24(15-18)33-34(30,31)20-12-10-19(26)11-13-20/h5-15,17H,4,16H2,1-3H3 |
| InChIKey | GGQFMAXVNCVWGS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|