C25H24Cl3NO5S — CID 71956868
[5-[[butan-2-yl-(2-chlorobenzoyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate (PubChem CID 71956868) has the molecular formula C25H24Cl3NO5S and a molecular weight of 556.90 g/mol. Its IUPAC name is [5-[[butan-2-yl-(2-chlorobenzoyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate.
| Compound Name | [5-[[butan-2-yl-(2-chlorobenzoyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 71956868 |
| Molecular Formula | C25H24Cl3NO5S |
| Molecular Weight | 556.90 g/mol |
| Exact Mass | 555.04 |
| IUPAC Name | [5-[[butan-2-yl-(2-chlorobenzoyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate |
| SMILES | CCC(C)N(Cc1ccc(OC)c(OS(=O)(=O)c2ccc(Cl)c(Cl)c2)c1)C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C25H24Cl3NO5S/c1-4-16(2)29(25(30)19-7-5-6-8-20(19)26)15-17-9-12-23(33-3)24(13-17)34-35(31,32)18-10-11-21(27)22(28)14-18/h5-14,16H,4,15H2,1-3H3 |
| InChIKey | NOXMVOBATUQCEE-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.90 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|