C30H28F3NO5S — CID 98335920
[5-[[[(2S)-butan-2-yl]-(naphthalene-1-carbonyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 98335920) has the molecular formula C30H28F3NO5S and a molecular weight of 571.62 g/mol. Its IUPAC name is [5-[[[(2S)-butan-2-yl]-(naphthalene-1-carbonyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [5-[[[(2S)-butan-2-yl]-(naphthalene-1-carbonyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 98335920 |
| Molecular Formula | C30H28F3NO5S |
| Molecular Weight | 571.62 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | [5-[[[(2S)-butan-2-yl]-(naphthalene-1-carbonyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CC[C@H](C)N(Cc1ccc(OC)c(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1)C(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C30H28F3NO5S/c1-4-20(2)34(29(35)26-14-7-10-22-9-5-6-13-25(22)26)19-21-15-16-27(38-3)28(17-21)39-40(36,37)24-12-8-11-23(18-24)30(31,32)33/h5-18,20H,4,19H2,1-3H3/t20-/m0/s1 |
| InChIKey | JAVCUFCFSJKSNI-FQEVSTJZSA-N |
| XLogP | 7.08 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.62 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|