C28H27F3N2O7S — CID 4606438
[5-[[butan-2-yl-[3-(4-nitrophenyl)prop-2-enoyl]amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 4606438) has the molecular formula C28H27F3N2O7S and a molecular weight of 592.59 g/mol. Its IUPAC name is [5-[[butan-2-yl-[3-(4-nitrophenyl)prop-2-enoyl]amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [5-[[butan-2-yl-[3-(4-nitrophenyl)prop-2-enoyl]amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 4606438 |
| Molecular Formula | C28H27F3N2O7S |
| Molecular Weight | 592.59 g/mol |
| Exact Mass | 592.15 |
| IUPAC Name | [5-[[butan-2-yl-[3-(4-nitrophenyl)prop-2-enoyl]amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CCC(C)N(Cc1ccc(OC)c(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1)C(=O)C=Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H27F3N2O7S/c1-4-19(2)32(27(34)15-11-20-8-12-23(13-9-20)33(35)36)18-21-10-14-25(39-3)26(16-21)40-41(37,38)24-7-5-6-22(17-24)28(29,30)31/h5-17,19H,4,18H2,1-3H3 |
| InChIKey | UTJRPAMSJBUYJI-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.59 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|