C27H26F3NO4S — CID 6148406
[4-[[butan-2-yl-[(E)-3-phenylprop-2-enoyl]amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 6148406) has the molecular formula C27H26F3NO4S and a molecular weight of 517.57 g/mol. Its IUPAC name is [4-[[butan-2-yl-[(E)-3-phenylprop-2-enoyl]amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [4-[[butan-2-yl-[(E)-3-phenylprop-2-enoyl]amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 6148406 |
| Molecular Formula | C27H26F3NO4S |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | [4-[[butan-2-yl-[(E)-3-phenylprop-2-enoyl]amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CCC(C)N(Cc1ccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C27H26F3NO4S/c1-3-20(2)31(26(32)17-14-21-8-5-4-6-9-21)19-22-12-15-24(16-13-22)35-36(33,34)25-11-7-10-23(18-25)27(28,29)30/h4-18,20H,3,19H2,1-2H3/b17-14+ |
| InChIKey | GNFLATFJKYHCFX-SAPNQHFASA-N |
| XLogP | 6.31 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|