C31H28F3NO4S — CID 5210463
[4-[[2-methylpropyl-(4-phenylbenzoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 5210463) has the molecular formula C31H28F3NO4S and a molecular weight of 567.63 g/mol. Its IUPAC name is [4-[[2-methylpropyl-(4-phenylbenzoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [4-[[2-methylpropyl-(4-phenylbenzoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 5210463 |
| Molecular Formula | C31H28F3NO4S |
| Molecular Weight | 567.63 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | [4-[[2-methylpropyl-(4-phenylbenzoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)CN(Cc1ccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1)C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H28F3NO4S/c1-22(2)20-35(30(36)26-15-13-25(14-16-26)24-7-4-3-5-8-24)21-23-11-17-28(18-12-23)39-40(37,38)29-10-6-9-27(19-29)31(32,33)34/h3-19,22H,20-21H2,1-2H3 |
| InChIKey | LVOHRHYMKDAGTI-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.63 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|