C23H28F3NO4S — CID 3462061
[4-[[3-methylbutanoyl(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 3462061) has the molecular formula C23H28F3NO4S and a molecular weight of 471.54 g/mol. Its IUPAC name is [4-[[3-methylbutanoyl(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [4-[[3-methylbutanoyl(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 3462061 |
| Molecular Formula | C23H28F3NO4S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | [4-[[3-methylbutanoyl(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)CC(=O)N(Cc1ccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1)CC(C)C |
| InChI | InChI=1S/C23H28F3NO4S/c1-16(2)12-22(28)27(14-17(3)4)15-18-8-10-20(11-9-18)31-32(29,30)21-7-5-6-19(13-21)23(24,25)26/h5-11,13,16-17H,12,14-15H2,1-4H3 |
| InChIKey | HTWFWCODGURABI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|