C25H32F3NO5S — CID 3660127
[4-[[2-methoxyethyl(octanoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 3660127) has the molecular formula C25H32F3NO5S and a molecular weight of 515.59 g/mol. Its IUPAC name is [4-[[2-methoxyethyl(octanoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [4-[[2-methoxyethyl(octanoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 3660127 |
| Molecular Formula | C25H32F3NO5S |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | [4-[[2-methoxyethyl(octanoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CCCCCCCC(=O)N(CCOC)Cc1ccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C25H32F3NO5S/c1-3-4-5-6-7-11-24(30)29(16-17-33-2)19-20-12-14-22(15-13-20)34-35(31,32)23-10-8-9-21(18-23)25(26,27)28/h8-10,12-15,18H,3-7,11,16-17,19H2,1-2H3 |
| InChIKey | NFSCZOKLODHETL-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|