C20H22F3NO5S — CID 4684038
[3-[[2-methoxyethyl(propanoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 4684038) has the molecular formula C20H22F3NO5S and a molecular weight of 445.46 g/mol. Its IUPAC name is [3-[[2-methoxyethyl(propanoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[2-methoxyethyl(propanoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 4684038 |
| Molecular Formula | C20H22F3NO5S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | [3-[[2-methoxyethyl(propanoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CCC(=O)N(CCOC)Cc1cccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C20H22F3NO5S/c1-3-19(25)24(10-11-28-2)14-15-6-4-8-17(12-15)29-30(26,27)18-9-5-7-16(13-18)20(21,22)23/h4-9,12-13H,3,10-11,14H2,1-2H3 |
| InChIKey | JLDZGUQAVJSSOS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|