C24H21F4NO5S — CID 4164480
[3-[[(2-fluorobenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 4164480) has the molecular formula C24H21F4NO5S and a molecular weight of 511.49 g/mol. Its IUPAC name is [3-[[(2-fluorobenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[(2-fluorobenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 4164480 |
| Molecular Formula | C24H21F4NO5S |
| Molecular Weight | 511.49 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | [3-[[(2-fluorobenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | COCCN(Cc1cccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1)C(=O)c1ccccc1F |
| InChI | InChI=1S/C24H21F4NO5S/c1-33-13-12-29(23(30)21-10-2-3-11-22(21)25)16-17-6-4-8-19(14-17)34-35(31,32)20-9-5-7-18(15-20)24(26,27)28/h2-11,14-15H,12-13,16H2,1H3 |
| InChIKey | XQFWTIIPUWJMQD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|