C28H30F3NO5S — CID 4677746
[3-[[(4-tert-butylbenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 4677746) has the molecular formula C28H30F3NO5S and a molecular weight of 549.61 g/mol. Its IUPAC name is [3-[[(4-tert-butylbenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[(4-tert-butylbenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 4677746 |
| Molecular Formula | C28H30F3NO5S |
| Molecular Weight | 549.61 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | [3-[[(4-tert-butylbenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | COCCN(Cc1cccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1)C(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H30F3NO5S/c1-27(2,3)22-13-11-21(12-14-22)26(33)32(15-16-36-4)19-20-7-5-9-24(17-20)37-38(34,35)25-10-6-8-23(18-25)28(29,30)31/h5-14,17-18H,15-16,19H2,1-4H3 |
| InChIKey | IUGIAQGOEKISCD-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.61 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|