C24H20ClF3N2O7S — CID 4181321
[3-[[(2-chloro-4-nitrobenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 4181321) has the molecular formula C24H20ClF3N2O7S and a molecular weight of 572.95 g/mol. Its IUPAC name is [3-[[(2-chloro-4-nitrobenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[(2-chloro-4-nitrobenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 4181321 |
| Molecular Formula | C24H20ClF3N2O7S |
| Molecular Weight | 572.95 g/mol |
| Exact Mass | 572.06 |
| IUPAC Name | [3-[[(2-chloro-4-nitrobenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | COCCN(Cc1cccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1)C(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C24H20ClF3N2O7S/c1-36-11-10-29(23(31)21-9-8-18(30(32)33)14-22(21)25)15-16-4-2-6-19(12-16)37-38(34,35)20-7-3-5-17(13-20)24(26,27)28/h2-9,12-14H,10-11,15H2,1H3 |
| InChIKey | AXLVTHZCVOUNPC-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.95 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|