C23H20ClFN2O6S — CID 4051104
[3-[[(2-chloro-4-nitrobenzoyl)-propan-2-ylamino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 4051104) has the molecular formula C23H20ClFN2O6S and a molecular weight of 506.94 g/mol. Its IUPAC name is [3-[[(2-chloro-4-nitrobenzoyl)-propan-2-ylamino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[(2-chloro-4-nitrobenzoyl)-propan-2-ylamino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 4051104 |
| Molecular Formula | C23H20ClFN2O6S |
| Molecular Weight | 506.94 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | [3-[[(2-chloro-4-nitrobenzoyl)-propan-2-ylamino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CC(C)N(Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1)C(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C23H20ClFN2O6S/c1-15(2)26(23(28)21-11-8-18(27(29)30)13-22(21)24)14-16-4-3-5-19(12-16)33-34(31,32)20-9-6-17(25)7-10-20/h3-13,15H,14H2,1-2H3 |
| InChIKey | NXLKFXKPLHDXMS-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.94 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|