C23H30FNO4S — CID 92519061
[3-[[[(2S)-butan-2-yl]-(3,3-dimethylbutanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 92519061) has the molecular formula C23H30FNO4S and a molecular weight of 435.56 g/mol. Its IUPAC name is [3-[[[(2S)-butan-2-yl]-(3,3-dimethylbutanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[[(2S)-butan-2-yl]-(3,3-dimethylbutanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 92519061 |
| Molecular Formula | C23H30FNO4S |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | [3-[[[(2S)-butan-2-yl]-(3,3-dimethylbutanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CC[C@H](C)N(Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C23H30FNO4S/c1-6-17(2)25(22(26)15-23(3,4)5)16-18-8-7-9-20(14-18)29-30(27,28)21-12-10-19(24)11-13-21/h7-14,17H,6,15-16H2,1-5H3/t17-/m0/s1 |
| InChIKey | DIJJRRMQGZWMRF-KRWDZBQOSA-N |
| XLogP | 5.16 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|