C25H26FNO5S — CID 93301845
[3-[[[(2R)-butan-2-yl]-(2-fluorobenzoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate (PubChem CID 93301845) has the molecular formula C25H26FNO5S and a molecular weight of 471.55 g/mol. Its IUPAC name is [3-[[[(2R)-butan-2-yl]-(2-fluorobenzoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate.
| Compound Name | [3-[[[(2R)-butan-2-yl]-(2-fluorobenzoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 93301845 |
| Molecular Formula | C25H26FNO5S |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | [3-[[[(2R)-butan-2-yl]-(2-fluorobenzoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate |
| SMILES | CC[C@@H](C)N(Cc1cccc(OS(=O)(=O)c2ccc(OC)cc2)c1)C(=O)c1ccccc1F |
| InChI | InChI=1S/C25H26FNO5S/c1-4-18(2)27(25(28)23-10-5-6-11-24(23)26)17-19-8-7-9-21(16-19)32-33(29,30)22-14-12-20(31-3)13-15-22/h5-16,18H,4,17H2,1-3H3/t18-/m1/s1 |
| InChIKey | LUGODRSTSRILCW-GOSISDBHSA-N |
| XLogP | 5.04 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|