C23H25NO5S2 — CID 93301761
[3-[[[(2R)-butan-2-yl]-(thiophene-2-carbonyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate (PubChem CID 93301761) has the molecular formula C23H25NO5S2 and a molecular weight of 459.59 g/mol. Its IUPAC name is [3-[[[(2R)-butan-2-yl]-(thiophene-2-carbonyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate.
| Compound Name | [3-[[[(2R)-butan-2-yl]-(thiophene-2-carbonyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 93301761 |
| Molecular Formula | C23H25NO5S2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | [3-[[[(2R)-butan-2-yl]-(thiophene-2-carbonyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate |
| SMILES | CC[C@@H](C)N(Cc1cccc(OS(=O)(=O)c2ccc(OC)cc2)c1)C(=O)c1cccs1 |
| InChI | InChI=1S/C23H25NO5S2/c1-4-17(2)24(23(25)22-9-6-14-30-22)16-18-7-5-8-20(15-18)29-31(26,27)21-12-10-19(28-3)11-13-21/h5-15,17H,4,16H2,1-3H3/t17-/m1/s1 |
| InChIKey | FMQKJFHUCCRWIU-QGZVFWFLSA-N |
| XLogP | 4.97 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|