C24H24F3NO5S2 — CID 3298312
[5-[[butan-2-yl(thiophene-2-carbonyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 3298312) has the molecular formula C24H24F3NO5S2 and a molecular weight of 527.59 g/mol. Its IUPAC name is [5-[[butan-2-yl(thiophene-2-carbonyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [5-[[butan-2-yl(thiophene-2-carbonyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 3298312 |
| Molecular Formula | C24H24F3NO5S2 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.10 |
| IUPAC Name | [5-[[butan-2-yl(thiophene-2-carbonyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CCC(C)N(Cc1ccc(OC)c(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1)C(=O)c1cccs1 |
| InChI | InChI=1S/C24H24F3NO5S2/c1-4-16(2)28(23(29)22-9-6-12-34-22)15-17-10-11-20(32-3)21(13-17)33-35(30,31)19-8-5-7-18(14-19)24(25,26)27/h5-14,16H,4,15H2,1-3H3 |
| InChIKey | QNWRUAVOBYBSDL-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|