C26H25ClF3NO5S — CID 71955211
[5-[[(2-chlorobenzoyl)-(2-methylpropyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 71955211) has the molecular formula C26H25ClF3NO5S and a molecular weight of 556.00 g/mol. Its IUPAC name is [5-[[(2-chlorobenzoyl)-(2-methylpropyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [5-[[(2-chlorobenzoyl)-(2-methylpropyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 71955211 |
| Molecular Formula | C26H25ClF3NO5S |
| Molecular Weight | 556.00 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | [5-[[(2-chlorobenzoyl)-(2-methylpropyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | COc1ccc(CN(CC(C)C)C(=O)c2ccccc2Cl)cc1OS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H25ClF3NO5S/c1-17(2)15-31(25(32)21-9-4-5-10-22(21)27)16-18-11-12-23(35-3)24(13-18)36-37(33,34)20-8-6-7-19(14-20)26(28,29)30/h4-14,17H,15-16H2,1-3H3 |
| InChIKey | CISHEOFOCVJPIE-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.00 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|