C24H30F3NO6S — CID 71955651
[5-[[3,3-dimethylbutanoyl(2-methoxyethyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 71955651) has the molecular formula C24H30F3NO6S and a molecular weight of 517.57 g/mol. Its IUPAC name is [5-[[3,3-dimethylbutanoyl(2-methoxyethyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [5-[[3,3-dimethylbutanoyl(2-methoxyethyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 71955651 |
| Molecular Formula | C24H30F3NO6S |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | [5-[[3,3-dimethylbutanoyl(2-methoxyethyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | COCCN(Cc1ccc(OC)c(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C24H30F3NO6S/c1-23(2,3)15-22(29)28(11-12-32-4)16-17-9-10-20(33-5)21(13-17)34-35(30,31)19-8-6-7-18(14-19)24(25,26)27/h6-10,13-14H,11-12,15-16H2,1-5H3 |
| InChIKey | KOAXJASGJVZVKR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|