C26H34F3NO6S — CID 98402971
[5-[[[(2S)-2-ethylhexanoyl]-(2-methoxyethyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 98402971) has the molecular formula C26H34F3NO6S and a molecular weight of 545.62 g/mol. Its IUPAC name is [5-[[[(2S)-2-ethylhexanoyl]-(2-methoxyethyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [5-[[[(2S)-2-ethylhexanoyl]-(2-methoxyethyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 98402971 |
| Molecular Formula | C26H34F3NO6S |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | [5-[[[(2S)-2-ethylhexanoyl]-(2-methoxyethyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CCCC[C@H](CC)C(=O)N(CCOC)Cc1ccc(OC)c(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C26H34F3NO6S/c1-5-7-9-20(6-2)25(31)30(14-15-34-3)18-19-12-13-23(35-4)24(16-19)36-37(32,33)22-11-8-10-21(17-22)26(27,28)29/h8,10-13,16-17,20H,5-7,9,14-15,18H2,1-4H3/t20-/m0/s1 |
| InChIKey | TWCQDTHWWGGXQL-FQEVSTJZSA-N |
| XLogP | 5.67 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|