C26H26F3NO7S — CID 3488574
[3-[[(2,6-dimethoxybenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 3488574) has the molecular formula C26H26F3NO7S and a molecular weight of 553.56 g/mol. Its IUPAC name is [3-[[(2,6-dimethoxybenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[(2,6-dimethoxybenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 3488574 |
| Molecular Formula | C26H26F3NO7S |
| Molecular Weight | 553.56 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | [3-[[(2,6-dimethoxybenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | COCCN(Cc1cccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1)C(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C26H26F3NO7S/c1-34-14-13-30(25(31)24-22(35-2)11-6-12-23(24)36-3)17-18-7-4-9-20(15-18)37-38(32,33)21-10-5-8-19(16-21)26(27,28)29/h4-12,15-16H,13-14,17H2,1-3H3 |
| InChIKey | LXTYZAIPROHQMX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|