C26H34F3NO5S — CID 5143010
[3-[[2-methoxyethyl(nonanoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 5143010) has the molecular formula C26H34F3NO5S and a molecular weight of 529.62 g/mol. Its IUPAC name is [3-[[2-methoxyethyl(nonanoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[2-methoxyethyl(nonanoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 5143010 |
| Molecular Formula | C26H34F3NO5S |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | [3-[[2-methoxyethyl(nonanoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CCCCCCCCC(=O)N(CCOC)Cc1cccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C26H34F3NO5S/c1-3-4-5-6-7-8-15-25(31)30(16-17-34-2)20-21-11-9-13-23(18-21)35-36(32,33)24-14-10-12-22(19-24)26(27,28)29/h9-14,18-19H,3-8,15-17,20H2,1-2H3 |
| InChIKey | IFLKHDBJYLWNMQ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|