C24H22F4N2O5S — CID 3535924
[3-[[(3-fluorophenyl)carbamoyl-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 3535924) has the molecular formula C24H22F4N2O5S and a molecular weight of 526.51 g/mol. Its IUPAC name is [3-[[(3-fluorophenyl)carbamoyl-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[(3-fluorophenyl)carbamoyl-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 3535924 |
| Molecular Formula | C24H22F4N2O5S |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | [3-[[(3-fluorophenyl)carbamoyl-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | COCCN(Cc1cccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1)C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C24H22F4N2O5S/c1-34-12-11-30(23(31)29-20-8-4-7-19(25)15-20)16-17-5-2-9-21(13-17)35-36(32,33)22-10-3-6-18(14-22)24(26,27)28/h2-10,13-15H,11-12,16H2,1H3,(H,29,31) |
| InChIKey | KQQWYWHZKHBONL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|