C24H21Cl2F3N2O5S — CID 42775543
[3-[[(2,3-dichlorophenyl)carbamoyl-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 42775543) has the molecular formula C24H21Cl2F3N2O5S and a molecular weight of 577.41 g/mol. Its IUPAC name is [3-[[(2,3-dichlorophenyl)carbamoyl-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[(2,3-dichlorophenyl)carbamoyl-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 42775543 |
| Molecular Formula | C24H21Cl2F3N2O5S |
| Molecular Weight | 577.41 g/mol |
| Exact Mass | 576.05 |
| IUPAC Name | [3-[[(2,3-dichlorophenyl)carbamoyl-(2-methoxyethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | COCCN(Cc1cccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C24H21Cl2F3N2O5S/c1-35-12-11-31(23(32)30-21-10-4-9-20(25)22(21)26)15-16-5-2-7-18(13-16)36-37(33,34)19-8-3-6-17(14-19)24(27,28)29/h2-10,13-14H,11-12,15H2,1H3,(H,30,32) |
| InChIKey | VGHNECIMOJBXRL-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.41 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|