C27H29F3N2O5S — CID 4078062
[3-[[(2-ethoxyphenyl)carbamoyl-(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 4078062) has the molecular formula C27H29F3N2O5S and a molecular weight of 550.60 g/mol. Its IUPAC name is [3-[[(2-ethoxyphenyl)carbamoyl-(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[(2-ethoxyphenyl)carbamoyl-(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 4078062 |
| Molecular Formula | C27H29F3N2O5S |
| Molecular Weight | 550.60 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | [3-[[(2-ethoxyphenyl)carbamoyl-(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CCOc1ccccc1NC(=O)N(Cc1cccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1)CC(C)C |
| InChI | InChI=1S/C27H29F3N2O5S/c1-4-36-25-14-6-5-13-24(25)31-26(33)32(17-19(2)3)18-20-9-7-11-22(15-20)37-38(34,35)23-12-8-10-21(16-23)27(28,29)30/h5-16,19H,4,17-18H2,1-3H3,(H,31,33) |
| InChIKey | INFKZCINLUUXBY-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.60 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|