C21H25F3N2O4S — CID 71956619
[2-[[ethylcarbamoyl(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 71956619) has the molecular formula C21H25F3N2O4S and a molecular weight of 458.50 g/mol. Its IUPAC name is [2-[[ethylcarbamoyl(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [2-[[ethylcarbamoyl(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 71956619 |
| Molecular Formula | C21H25F3N2O4S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | [2-[[ethylcarbamoyl(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CCNC(=O)N(Cc1ccccc1OS(=O)(=O)c1cccc(C(F)(F)F)c1)CC(C)C |
| InChI | InChI=1S/C21H25F3N2O4S/c1-4-25-20(27)26(13-15(2)3)14-16-8-5-6-11-19(16)30-31(28,29)18-10-7-9-17(12-18)21(22,23)24/h5-12,15H,4,13-14H2,1-3H3,(H,25,27) |
| InChIKey | VYYVKPADRVMXSO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|