C25H23F4NO4S — CID 71955645
[2-[[butan-2-yl-(3-fluorobenzoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 71955645) has the molecular formula C25H23F4NO4S and a molecular weight of 509.52 g/mol. Its IUPAC name is [2-[[butan-2-yl-(3-fluorobenzoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [2-[[butan-2-yl-(3-fluorobenzoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 71955645 |
| Molecular Formula | C25H23F4NO4S |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | [2-[[butan-2-yl-(3-fluorobenzoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CCC(C)N(Cc1ccccc1OS(=O)(=O)c1cccc(C(F)(F)F)c1)C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C25H23F4NO4S/c1-3-17(2)30(24(31)18-9-6-11-21(26)14-18)16-19-8-4-5-13-23(19)34-35(32,33)22-12-7-10-20(15-22)25(27,28)29/h4-15,17H,3,16H2,1-2H3 |
| InChIKey | HWWIYFKAIYAFKN-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|