C22H27F3N2O4S — CID 71955664
[2-[[butan-2-yl(propan-2-ylcarbamoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 71955664) has the molecular formula C22H27F3N2O4S and a molecular weight of 472.53 g/mol. Its IUPAC name is [2-[[butan-2-yl(propan-2-ylcarbamoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [2-[[butan-2-yl(propan-2-ylcarbamoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 71955664 |
| Molecular Formula | C22H27F3N2O4S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | [2-[[butan-2-yl(propan-2-ylcarbamoyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CCC(C)N(Cc1ccccc1OS(=O)(=O)c1cccc(C(F)(F)F)c1)C(=O)NC(C)C |
| InChI | InChI=1S/C22H27F3N2O4S/c1-5-16(4)27(21(28)26-15(2)3)14-17-9-6-7-12-20(17)31-32(29,30)19-11-8-10-18(13-19)22(23,24)25/h6-13,15-16H,5,14H2,1-4H3,(H,26,28) |
| InChIKey | QVFHTXUMVFWCQO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|