C28H30ClF3N2O4S — CID 83272900
[2-[[(2-chlorobenzoyl)-propan-2-ylamino]methyl]-5-(diethylamino)phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 83272900) has the molecular formula C28H30ClF3N2O4S and a molecular weight of 583.07 g/mol. Its IUPAC name is [2-[[(2-chlorobenzoyl)-propan-2-ylamino]methyl]-5-(diethylamino)phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [2-[[(2-chlorobenzoyl)-propan-2-ylamino]methyl]-5-(diethylamino)phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 83272900 |
| Molecular Formula | C28H30ClF3N2O4S |
| Molecular Weight | 583.07 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | [2-[[(2-chlorobenzoyl)-propan-2-ylamino]methyl]-5-(diethylamino)phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CCN(CC)c1ccc(CN(C(=O)c2ccccc2Cl)C(C)C)c(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C28H30ClF3N2O4S/c1-5-33(6-2)22-15-14-20(18-34(19(3)4)27(35)24-12-7-8-13-25(24)29)26(17-22)38-39(36,37)23-11-9-10-21(16-23)28(30,31)32/h7-17,19H,5-6,18H2,1-4H3 |
| InChIKey | WAIQVUMTCBVHMT-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.07 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|