C27H29Cl3N2O4S — CID 83272904
[2-[[(2-chlorobenzoyl)-propan-2-ylamino]methyl]-5-(diethylamino)phenyl] 3,4-dichlorobenzenesulfonate (PubChem CID 83272904) has the molecular formula C27H29Cl3N2O4S and a molecular weight of 583.97 g/mol. Its IUPAC name is [2-[[(2-chlorobenzoyl)-propan-2-ylamino]methyl]-5-(diethylamino)phenyl] 3,4-dichlorobenzenesulfonate.
| Compound Name | [2-[[(2-chlorobenzoyl)-propan-2-ylamino]methyl]-5-(diethylamino)phenyl] 3,4-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 83272904 |
| Molecular Formula | C27H29Cl3N2O4S |
| Molecular Weight | 583.97 g/mol |
| Exact Mass | 582.09 |
| IUPAC Name | [2-[[(2-chlorobenzoyl)-propan-2-ylamino]methyl]-5-(diethylamino)phenyl] 3,4-dichlorobenzenesulfonate |
| SMILES | CCN(CC)c1ccc(CN(C(=O)c2ccccc2Cl)C(C)C)c(OS(=O)(=O)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C27H29Cl3N2O4S/c1-5-31(6-2)20-12-11-19(17-32(18(3)4)27(33)22-9-7-8-10-23(22)28)26(15-20)36-37(34,35)21-13-14-24(29)25(30)16-21/h7-16,18H,5-6,17H2,1-4H3 |
| InChIKey | SFAPGASTUWRLSR-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.97 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|