C27H26Cl2N2O6S — CID 83273465
[5-(diethylamino)-2-[[furan-2-carbonyl(furan-2-ylmethyl)amino]methyl]phenyl] 3,4-dichlorobenzenesulfonate (PubChem CID 83273465) has the molecular formula C27H26Cl2N2O6S and a molecular weight of 577.49 g/mol. Its IUPAC name is [5-(diethylamino)-2-[[furan-2-carbonyl(furan-2-ylmethyl)amino]methyl]phenyl] 3,4-dichlorobenzenesulfonate.
| Compound Name | [5-(diethylamino)-2-[[furan-2-carbonyl(furan-2-ylmethyl)amino]methyl]phenyl] 3,4-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 83273465 |
| Molecular Formula | C27H26Cl2N2O6S |
| Molecular Weight | 577.49 g/mol |
| Exact Mass | 576.09 |
| IUPAC Name | [5-(diethylamino)-2-[[furan-2-carbonyl(furan-2-ylmethyl)amino]methyl]phenyl] 3,4-dichlorobenzenesulfonate |
| SMILES | CCN(CC)c1ccc(CN(Cc2ccco2)C(=O)c2ccco2)c(OS(=O)(=O)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C27H26Cl2N2O6S/c1-3-30(4-2)20-10-9-19(26(15-20)37-38(33,34)22-11-12-23(28)24(29)16-22)17-31(18-21-7-5-13-35-21)27(32)25-8-6-14-36-25/h5-16H,3-4,17-18H2,1-2H3 |
| InChIKey | SLMXZGNKIPUOQP-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 93.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.49 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|