C21H19Cl2NO6S — CID 71955237
[5-[[acetyl(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate (PubChem CID 71955237) has the molecular formula C21H19Cl2NO6S and a molecular weight of 484.36 g/mol. Its IUPAC name is [5-[[acetyl(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate.
| Compound Name | [5-[[acetyl(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 71955237 |
| Molecular Formula | C21H19Cl2NO6S |
| Molecular Weight | 484.36 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | [5-[[acetyl(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] 3,4-dichlorobenzenesulfonate |
| SMILES | COc1ccc(CN(Cc2ccco2)C(C)=O)cc1OS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H19Cl2NO6S/c1-14(25)24(13-16-4-3-9-29-16)12-15-5-8-20(28-2)21(10-15)30-31(26,27)17-6-7-18(22)19(23)11-17/h3-11H,12-13H2,1-2H3 |
| InChIKey | VDRCPTBURYUBRV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.36 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|