C28H24Cl2N2O7S — CID 175511109
[5-[[(2,6-dichlorobenzoyl)-(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] 4-acetamidobenzenesulfonate (PubChem CID 175511109) has the molecular formula C28H24Cl2N2O7S and a molecular weight of 603.48 g/mol. Its IUPAC name is [5-[[(2,6-dichlorobenzoyl)-(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [5-[[(2,6-dichlorobenzoyl)-(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 175511109 |
| Molecular Formula | C28H24Cl2N2O7S |
| Molecular Weight | 603.48 g/mol |
| Exact Mass | 602.07 |
| IUPAC Name | [5-[[(2,6-dichlorobenzoyl)-(furan-2-ylmethyl)amino]methyl]-2-methoxyphenyl] 4-acetamidobenzenesulfonate |
| SMILES | COc1ccc(CN(Cc2ccco2)C(=O)c2c(Cl)cccc2Cl)cc1OS(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C28H24Cl2N2O7S/c1-18(33)31-20-9-11-22(12-10-20)40(35,36)39-26-15-19(8-13-25(26)37-2)16-32(17-21-5-4-14-38-21)28(34)27-23(29)6-3-7-24(27)30/h3-15H,16-17H2,1-2H3,(H,31,33) |
| InChIKey | PGSXGJKLIVOJMB-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.48 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|