C25H33N3O6S — CID 83283067
[5-[[cyclobutanecarbonyl-[2-(dimethylamino)ethyl]amino]methyl]-2-methoxyphenyl] 4-acetamidobenzenesulfonate (PubChem CID 83283067) has the molecular formula C25H33N3O6S and a molecular weight of 503.62 g/mol. Its IUPAC name is [5-[[cyclobutanecarbonyl-[2-(dimethylamino)ethyl]amino]methyl]-2-methoxyphenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [5-[[cyclobutanecarbonyl-[2-(dimethylamino)ethyl]amino]methyl]-2-methoxyphenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 83283067 |
| Molecular Formula | C25H33N3O6S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | [5-[[cyclobutanecarbonyl-[2-(dimethylamino)ethyl]amino]methyl]-2-methoxyphenyl] 4-acetamidobenzenesulfonate |
| SMILES | COc1ccc(CN(CCN(C)C)C(=O)C2CCC2)cc1OS(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C25H33N3O6S/c1-18(29)26-21-9-11-22(12-10-21)35(31,32)34-24-16-19(8-13-23(24)33-4)17-28(15-14-27(2)3)25(30)20-6-5-7-20/h8-13,16,20H,5-7,14-15,17H2,1-4H3,(H,26,29) |
| InChIKey | LCFYULFCUNUEJY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|