C26H28ClN3O5S — CID 42811387
[3-[[(2-chlorobenzoyl)-[2-(dimethylamino)ethyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate (PubChem CID 42811387) has the molecular formula C26H28ClN3O5S and a molecular weight of 530.05 g/mol. Its IUPAC name is [3-[[(2-chlorobenzoyl)-[2-(dimethylamino)ethyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [3-[[(2-chlorobenzoyl)-[2-(dimethylamino)ethyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 42811387 |
| Molecular Formula | C26H28ClN3O5S |
| Molecular Weight | 530.05 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | [3-[[(2-chlorobenzoyl)-[2-(dimethylamino)ethyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Oc2cccc(CN(CCN(C)C)C(=O)c3ccccc3Cl)c2)cc1 |
| InChI | InChI=1S/C26H28ClN3O5S/c1-19(31)28-21-11-13-23(14-12-21)36(33,34)35-22-8-6-7-20(17-22)18-30(16-15-29(2)3)26(32)24-9-4-5-10-25(24)27/h4-14,17H,15-16,18H2,1-3H3,(H,28,31) |
| InChIKey | QMWQGOCBTDHFGJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.05 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|