C22H29N3O5S — CID 93301769
[3-[[[(2R)-butan-2-yl]-(ethylcarbamoyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate (PubChem CID 93301769) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is [3-[[[(2R)-butan-2-yl]-(ethylcarbamoyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [3-[[[(2R)-butan-2-yl]-(ethylcarbamoyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 93301769 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | [3-[[[(2R)-butan-2-yl]-(ethylcarbamoyl)amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
| SMILES | CCNC(=O)N(Cc1cccc(OS(=O)(=O)c2ccc(NC(C)=O)cc2)c1)[C@H](C)CC |
| InChI | InChI=1S/C22H29N3O5S/c1-5-16(3)25(22(27)23-6-2)15-18-8-7-9-20(14-18)30-31(28,29)21-12-10-19(11-13-21)24-17(4)26/h7-14,16H,5-6,15H2,1-4H3,(H,23,27)(H,24,26)/t16-/m1/s1 |
| InChIKey | PYMFCSGLEVVSFC-MRXNPFEDSA-N |
| XLogP | 3.74 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|