C23H29ClN2O4S — CID 91634131
[3-[[cyclobutanecarbonyl-[2-(dimethylamino)ethyl]amino]methyl]phenyl] 2-chloro-6-methylbenzenesulfonate (PubChem CID 91634131) has the molecular formula C23H29ClN2O4S and a molecular weight of 465.02 g/mol. Its IUPAC name is [3-[[cyclobutanecarbonyl-[2-(dimethylamino)ethyl]amino]methyl]phenyl] 2-chloro-6-methylbenzenesulfonate.
| Compound Name | [3-[[cyclobutanecarbonyl-[2-(dimethylamino)ethyl]amino]methyl]phenyl] 2-chloro-6-methylbenzenesulfonate |
|---|---|
| PubChem CID | 91634131 |
| Molecular Formula | C23H29ClN2O4S |
| Molecular Weight | 465.02 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | [3-[[cyclobutanecarbonyl-[2-(dimethylamino)ethyl]amino]methyl]phenyl] 2-chloro-6-methylbenzenesulfonate |
| SMILES | Cc1cccc(Cl)c1S(=O)(=O)Oc1cccc(CN(CCN(C)C)C(=O)C2CCC2)c1 |
| InChI | InChI=1S/C23H29ClN2O4S/c1-17-7-4-12-21(24)22(17)31(28,29)30-20-11-5-8-18(15-20)16-26(14-13-25(2)3)23(27)19-9-6-10-19/h4-5,7-8,11-12,15,19H,6,9-10,13-14,16H2,1-3H3 |
| InChIKey | ZGIUKRNQCKEABP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.02 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|