C23H21ClFNO4S — CID 71955236
[3-[[acetyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 2-chloro-6-methylbenzenesulfonate (PubChem CID 71955236) has the molecular formula C23H21ClFNO4S and a molecular weight of 461.94 g/mol. Its IUPAC name is [3-[[acetyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 2-chloro-6-methylbenzenesulfonate.
| Compound Name | [3-[[acetyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 2-chloro-6-methylbenzenesulfonate |
|---|---|
| PubChem CID | 71955236 |
| Molecular Formula | C23H21ClFNO4S |
| Molecular Weight | 461.94 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | [3-[[acetyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 2-chloro-6-methylbenzenesulfonate |
| SMILES | CC(=O)N(Cc1ccc(F)cc1)Cc1cccc(OS(=O)(=O)c2c(C)cccc2Cl)c1 |
| InChI | InChI=1S/C23H21ClFNO4S/c1-16-5-3-8-22(24)23(16)31(28,29)30-21-7-4-6-19(13-21)15-26(17(2)27)14-18-9-11-20(25)12-10-18/h3-13H,14-15H2,1-2H3 |
| InChIKey | XBEOQVGIMBWFRZ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.94 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|