C25H25ClFNO4S — CID 71956601
[4-[[(2-fluorobenzoyl)-(2-methylpropyl)amino]methyl]phenyl] 2-chloro-6-methylbenzenesulfonate (PubChem CID 71956601) has the molecular formula C25H25ClFNO4S and a molecular weight of 490.00 g/mol. Its IUPAC name is [4-[[(2-fluorobenzoyl)-(2-methylpropyl)amino]methyl]phenyl] 2-chloro-6-methylbenzenesulfonate.
| Compound Name | [4-[[(2-fluorobenzoyl)-(2-methylpropyl)amino]methyl]phenyl] 2-chloro-6-methylbenzenesulfonate |
|---|---|
| PubChem CID | 71956601 |
| Molecular Formula | C25H25ClFNO4S |
| Molecular Weight | 490.00 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | [4-[[(2-fluorobenzoyl)-(2-methylpropyl)amino]methyl]phenyl] 2-chloro-6-methylbenzenesulfonate |
| SMILES | Cc1cccc(Cl)c1S(=O)(=O)Oc1ccc(CN(CC(C)C)C(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C25H25ClFNO4S/c1-17(2)15-28(25(29)21-8-4-5-10-23(21)27)16-19-11-13-20(14-12-19)32-33(30,31)24-18(3)7-6-9-22(24)26/h4-14,17H,15-16H2,1-3H3 |
| InChIKey | DMZLLZDQOFLLQQ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.00 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|