C23H28ClNO4S — CID 71956569
[4-[[cyclopropyl(3,3-dimethylbutanoyl)amino]methyl]phenyl] 2-chloro-6-methylbenzenesulfonate (PubChem CID 71956569) has the molecular formula C23H28ClNO4S and a molecular weight of 450.00 g/mol. Its IUPAC name is [4-[[cyclopropyl(3,3-dimethylbutanoyl)amino]methyl]phenyl] 2-chloro-6-methylbenzenesulfonate.
| Compound Name | [4-[[cyclopropyl(3,3-dimethylbutanoyl)amino]methyl]phenyl] 2-chloro-6-methylbenzenesulfonate |
|---|---|
| PubChem CID | 71956569 |
| Molecular Formula | C23H28ClNO4S |
| Molecular Weight | 450.00 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | [4-[[cyclopropyl(3,3-dimethylbutanoyl)amino]methyl]phenyl] 2-chloro-6-methylbenzenesulfonate |
| SMILES | Cc1cccc(Cl)c1S(=O)(=O)Oc1ccc(CN(C(=O)CC(C)(C)C)C2CC2)cc1 |
| InChI | InChI=1S/C23H28ClNO4S/c1-16-6-5-7-20(24)22(16)30(27,28)29-19-12-8-17(9-13-19)15-25(18-10-11-18)21(26)14-23(2,3)4/h5-9,12-13,18H,10-11,14-15H2,1-4H3 |
| InChIKey | DNWTTXSEQULDEW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.00 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|