C20H33N2O4P — CID 23731868
[4-[[(4-aminocyclohexyl)-(3,3-dimethylbutanoyl)amino]methyl]phenyl]methylphosphonic acid (PubChem CID 23731868) has the molecular formula C20H33N2O4P and a molecular weight of 396.47 g/mol. Its IUPAC name is [4-[[(4-aminocyclohexyl)-(3,3-dimethylbutanoyl)amino]methyl]phenyl]methylphosphonic acid.
| Compound Name | [4-[[(4-aminocyclohexyl)-(3,3-dimethylbutanoyl)amino]methyl]phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 23731868 |
| Molecular Formula | C20H33N2O4P |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | [4-[[(4-aminocyclohexyl)-(3,3-dimethylbutanoyl)amino]methyl]phenyl]methylphosphonic acid |
| SMILES | CC(C)(C)CC(=O)N(Cc1ccc(CP(=O)(O)O)cc1)C1CCC(N)CC1 |
| InChI | InChI=1S/C20H33N2O4P/c1-20(2,3)12-19(23)22(18-10-8-17(21)9-11-18)13-15-4-6-16(7-5-15)14-27(24,25)26/h4-7,17-18H,8-14,21H2,1-3H3,(H2,24,25,26) |
| InChIKey | XVESKHIEFSEQJT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|