C22H28N3O3P — CID 23994313
[4-[[(4-aminocyclohexyl)-[(4-cyanophenyl)methyl]amino]methyl]phenyl]methylphosphonic acid (PubChem CID 23994313) has the molecular formula C22H28N3O3P and a molecular weight of 413.46 g/mol. Its IUPAC name is [4-[[(4-aminocyclohexyl)-[(4-cyanophenyl)methyl]amino]methyl]phenyl]methylphosphonic acid.
| Compound Name | [4-[[(4-aminocyclohexyl)-[(4-cyanophenyl)methyl]amino]methyl]phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 23994313 |
| Molecular Formula | C22H28N3O3P |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | [4-[[(4-aminocyclohexyl)-[(4-cyanophenyl)methyl]amino]methyl]phenyl]methylphosphonic acid |
| SMILES | N#Cc1ccc(CN(Cc2ccc(CP(=O)(O)O)cc2)C2CCC(N)CC2)cc1 |
| InChI | InChI=1S/C22H28N3O3P/c23-13-17-1-3-18(4-2-17)14-25(22-11-9-21(24)10-12-22)15-19-5-7-20(8-6-19)16-29(26,27)28/h1-8,21-22H,9-12,14-16,24H2,(H2,26,27,28) |
| InChIKey | QDSXECGJUYPKKZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 110.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|