C29H30N4O3 — CID 23906844
benzyl N-[4-[[(4-aminocyclohexyl)-(4-cyanobenzoyl)amino]methyl]phenyl]carbamate (PubChem CID 23906844) has the molecular formula C29H30N4O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is benzyl N-[4-[[(4-aminocyclohexyl)-(4-cyanobenzoyl)amino]methyl]phenyl]carbamate.
| Compound Name | benzyl N-[4-[[(4-aminocyclohexyl)-(4-cyanobenzoyl)amino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 23906844 |
| Molecular Formula | C29H30N4O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | benzyl N-[4-[[(4-aminocyclohexyl)-(4-cyanobenzoyl)amino]methyl]phenyl]carbamate |
| SMILES | N#Cc1ccc(C(=O)N(Cc2ccc(NC(=O)OCc3ccccc3)cc2)C2CCC(N)CC2)cc1 |
| InChI | InChI=1S/C29H30N4O3/c30-18-21-6-10-24(11-7-21)28(34)33(27-16-12-25(31)13-17-27)19-22-8-14-26(15-9-22)32-29(35)36-20-23-4-2-1-3-5-23/h1-11,14-15,25,27H,12-13,16-17,19-20,31H2,(H,32,35) |
| InChIKey | SXRBYFADZFLDBW-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 108.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |