C28H27BrN4O2 — CID 23768602
N-[3-[[(4-aminocyclohexyl)-(4-cyanobenzoyl)amino]methyl]phenyl]-2-bromobenzamide (PubChem CID 23768602) has the molecular formula C28H27BrN4O2 and a molecular weight of 531.45 g/mol. Its IUPAC name is N-[3-[[(4-aminocyclohexyl)-(4-cyanobenzoyl)amino]methyl]phenyl]-2-bromobenzamide.
| Compound Name | N-[3-[[(4-aminocyclohexyl)-(4-cyanobenzoyl)amino]methyl]phenyl]-2-bromobenzamide |
|---|---|
| PubChem CID | 23768602 |
| Molecular Formula | C28H27BrN4O2 |
| Molecular Weight | 531.45 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | N-[3-[[(4-aminocyclohexyl)-(4-cyanobenzoyl)amino]methyl]phenyl]-2-bromobenzamide |
| SMILES | N#Cc1ccc(C(=O)N(Cc2cccc(NC(=O)c3ccccc3Br)c2)C2CCC(N)CC2)cc1 |
| InChI | InChI=1S/C28H27BrN4O2/c29-26-7-2-1-6-25(26)27(34)32-23-5-3-4-20(16-23)18-33(24-14-12-22(31)13-15-24)28(35)21-10-8-19(17-30)9-11-21/h1-11,16,22,24H,12-15,18,31H2,(H,32,34) |
| InChIKey | SYSHZYRXGNQBGW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.45 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |