C27H28BrN3O2 — CID 23820528
N-[3-[[(2-aminocyclohexyl)-benzoylamino]methyl]phenyl]-2-bromobenzamide (PubChem CID 23820528) has the molecular formula C27H28BrN3O2 and a molecular weight of 506.44 g/mol. Its IUPAC name is N-[3-[[(2-aminocyclohexyl)-benzoylamino]methyl]phenyl]-2-bromobenzamide.
| Compound Name | N-[3-[[(2-aminocyclohexyl)-benzoylamino]methyl]phenyl]-2-bromobenzamide |
|---|---|
| PubChem CID | 23820528 |
| Molecular Formula | C27H28BrN3O2 |
| Molecular Weight | 506.44 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | N-[3-[[(2-aminocyclohexyl)-benzoylamino]methyl]phenyl]-2-bromobenzamide |
| SMILES | NC1CCCCC1N(Cc1cccc(NC(=O)c2ccccc2Br)c1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C27H28BrN3O2/c28-23-14-5-4-13-22(23)26(32)30-21-12-8-9-19(17-21)18-31(25-16-7-6-15-24(25)29)27(33)20-10-2-1-3-11-20/h1-5,8-14,17,24-25H,6-7,15-16,18,29H2,(H,30,32) |
| InChIKey | JHCSRMOLJIDJFQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |