C27H27ClFN3O2 — CID 23855461
N-(2-aminocyclohexyl)-N-[[3-[(3-chlorobenzoyl)amino]phenyl]methyl]-3-fluorobenzamide (PubChem CID 23855461) has the molecular formula C27H27ClFN3O2 and a molecular weight of 479.98 g/mol. Its IUPAC name is N-(2-aminocyclohexyl)-N-[[3-[(3-chlorobenzoyl)amino]phenyl]methyl]-3-fluorobenzamide.
| Compound Name | N-(2-aminocyclohexyl)-N-[[3-[(3-chlorobenzoyl)amino]phenyl]methyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 23855461 |
| Molecular Formula | C27H27ClFN3O2 |
| Molecular Weight | 479.98 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | N-(2-aminocyclohexyl)-N-[[3-[(3-chlorobenzoyl)amino]phenyl]methyl]-3-fluorobenzamide |
| SMILES | NC1CCCCC1N(Cc1cccc(NC(=O)c2cccc(Cl)c2)c1)C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C27H27ClFN3O2/c28-21-9-4-7-19(15-21)26(33)31-23-11-3-6-18(14-23)17-32(25-13-2-1-12-24(25)30)27(34)20-8-5-10-22(29)16-20/h3-11,14-16,24-25H,1-2,12-13,17,30H2,(H,31,33) |
| InChIKey | TVAXQRTVKFOXBN-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.98 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |