C27H28FN3O2 — CID 23960191
N-[2-[[(2-aminocyclohexyl)-benzoylamino]methyl]phenyl]-3-fluorobenzamide (PubChem CID 23960191) has the molecular formula C27H28FN3O2 and a molecular weight of 445.54 g/mol. Its IUPAC name is N-[2-[[(2-aminocyclohexyl)-benzoylamino]methyl]phenyl]-3-fluorobenzamide.
| Compound Name | N-[2-[[(2-aminocyclohexyl)-benzoylamino]methyl]phenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 23960191 |
| Molecular Formula | C27H28FN3O2 |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | N-[2-[[(2-aminocyclohexyl)-benzoylamino]methyl]phenyl]-3-fluorobenzamide |
| SMILES | NC1CCCCC1N(Cc1ccccc1NC(=O)c1cccc(F)c1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C27H28FN3O2/c28-22-13-8-12-20(17-22)26(32)30-24-15-6-4-11-21(24)18-31(25-16-7-5-14-23(25)29)27(33)19-9-2-1-3-10-19/h1-4,6,8-13,15,17,23,25H,5,7,14,16,18,29H2,(H,30,32) |
| InChIKey | LNGKKAXXKYTBQJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |